C16H19N3O5 — CID 133353126
4-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]-N-methyl-3-nitrobenzamide (PubChem CID 133353126) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 4-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]-N-methyl-3-nitrobenzamide.
| Compound Name | 4-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 133353126 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 4-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]-N-methyl-3-nitrobenzamide |
| SMILES | CNC(=O)c1ccc(NCC(C)(O)c2ccc(C)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H19N3O5/c1-10-4-7-14(24-10)16(2,21)9-18-12-6-5-11(15(20)17-3)8-13(12)19(22)23/h4-8,18,21H,9H2,1-3H3,(H,17,20) |
| InChIKey | GZQJWYSDTLIVIG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|