C14H14F2N2O2S — CID 60904511
2-(difluoromethylsulfonyl)-N-(2-pyridin-4-ylethyl)aniline (PubChem CID 60904511) has the molecular formula C14H14F2N2O2S and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-N-(2-pyridin-4-ylethyl)aniline.
| Compound Name | 2-(difluoromethylsulfonyl)-N-(2-pyridin-4-ylethyl)aniline |
|---|---|
| PubChem CID | 60904511 |
| Molecular Formula | C14H14F2N2O2S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-N-(2-pyridin-4-ylethyl)aniline |
| SMILES | O=S(=O)(c1ccccc1NCCc1ccncc1)C(F)F |
| InChI | InChI=1S/C14H14F2N2O2S/c15-14(16)21(19,20)13-4-2-1-3-12(13)18-10-7-11-5-8-17-9-6-11/h1-6,8-9,14,18H,7,10H2 |
| InChIKey | JEDHVTUIURGKQJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |