About N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine
N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine (PubChem CID 62641444) has the molecular formula C13H20F2N2O2S
and a molecular weight of 306.38 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine |
| PubChem CID | 62641444 |
| Molecular Formula | C13H20F2N2O2S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)N(C)CCNc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C13H20F2N2O2S/c1-10(2)17(3)9-8-16-11-6-4-5-7-12(11)20(18,19)13(14)15/h4-7,10,13,16H,8-9H2,1-3H3 |
| InChIKey | GYDKYUDHINNSFW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine?
The IUPAC name of N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine (CID 62641444) is N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine.
What is the SMILES notation for N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine?
The canonical SMILES for N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine is CC(C)N(C)CCNc1ccccc1S(=O)(=O)C(F)F.
What is the InChIKey of N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine?
The InChIKey is GYDKYUDHINNSFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2N2O2S/c1-10(2)17(3)9-8-16-11-6-4-5-7-12(11)20(18,19)13(14)15/h4-7,10,13,16H,8-9H2,1-3H3.
What are the key properties of N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine?
N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine has a molecular weight of 306.38 g/mol, XLogP of 2.43, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(difluoromethylsulfonyl)phenyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine is sourced from PubChem (CID 62641444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).