C12H16ClF2NO2S — CID 113497856
N-(3-chloropentyl)-2-(difluoromethylsulfonyl)aniline (PubChem CID 113497856) has the molecular formula C12H16ClF2NO2S and a molecular weight of 311.78 g/mol. Its IUPAC name is N-(3-chloropentyl)-2-(difluoromethylsulfonyl)aniline.
| Compound Name | N-(3-chloropentyl)-2-(difluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 113497856 |
| Molecular Formula | C12H16ClF2NO2S |
| Molecular Weight | 311.78 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-(3-chloropentyl)-2-(difluoromethylsulfonyl)aniline |
| SMILES | CCC(Cl)CCNc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C12H16ClF2NO2S/c1-2-9(13)7-8-16-10-5-3-4-6-11(10)19(17,18)12(14)15/h3-6,9,12,16H,2,7-8H2,1H3 |
| InChIKey | VJOMHWLZMHGLTE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|