C13H19F2NO2S2 — CID 104925514
2-(difluoromethylsulfonyl)-N-(5-methylsulfanylpentyl)aniline (PubChem CID 104925514) has the molecular formula C13H19F2NO2S2 and a molecular weight of 323.43 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-N-(5-methylsulfanylpentyl)aniline.
| Compound Name | 2-(difluoromethylsulfonyl)-N-(5-methylsulfanylpentyl)aniline |
|---|---|
| PubChem CID | 104925514 |
| Molecular Formula | C13H19F2NO2S2 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-N-(5-methylsulfanylpentyl)aniline |
| SMILES | CSCCCCCNc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C13H19F2NO2S2/c1-19-10-6-2-5-9-16-11-7-3-4-8-12(11)20(17,18)13(14)15/h3-4,7-8,13,16H,2,5-6,9-10H2,1H3 |
| InChIKey | HUSMIHCKLNZWQI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|