C13H15F2N3O2S — CID 43455408
2-(difluoromethylsulfonyl)-N-(3-imidazol-1-ylpropyl)aniline (PubChem CID 43455408) has the molecular formula C13H15F2N3O2S and a molecular weight of 315.34 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-N-(3-imidazol-1-ylpropyl)aniline.
| Compound Name | 2-(difluoromethylsulfonyl)-N-(3-imidazol-1-ylpropyl)aniline |
|---|---|
| PubChem CID | 43455408 |
| Molecular Formula | C13H15F2N3O2S |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-N-(3-imidazol-1-ylpropyl)aniline |
| SMILES | O=S(=O)(c1ccccc1NCCCn1ccnc1)C(F)F |
| InChI | InChI=1S/C13H15F2N3O2S/c14-13(15)21(19,20)12-5-2-1-4-11(12)17-6-3-8-18-9-7-16-10-18/h1-2,4-5,7,9-10,13,17H,3,6,8H2 |
| InChIKey | HYPICPYDHSISAO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|