C14H16F3N3 — CID 62313288
N-(4-imidazol-1-ylbutyl)-2-(trifluoromethyl)aniline (PubChem CID 62313288) has the molecular formula C14H16F3N3 and a molecular weight of 283.30 g/mol. Its IUPAC name is N-(4-imidazol-1-ylbutyl)-2-(trifluoromethyl)aniline.
| Compound Name | N-(4-imidazol-1-ylbutyl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 62313288 |
| Molecular Formula | C14H16F3N3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-(4-imidazol-1-ylbutyl)-2-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccccc1NCCCCn1ccnc1 |
| InChI | InChI=1S/C14H16F3N3/c15-14(16,17)12-5-1-2-6-13(12)19-7-3-4-9-20-10-8-18-11-20/h1-2,5-6,8,10-11,19H,3-4,7,9H2 |
| InChIKey | SCYIUYCXKAYSCD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|