C14H18N4O2 — CID 115545705
2-amino-3-(4-imidazol-1-ylbutylamino)benzoic acid (PubChem CID 115545705) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-amino-3-(4-imidazol-1-ylbutylamino)benzoic acid.
| Compound Name | 2-amino-3-(4-imidazol-1-ylbutylamino)benzoic acid |
|---|---|
| PubChem CID | 115545705 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-amino-3-(4-imidazol-1-ylbutylamino)benzoic acid |
| SMILES | Nc1c(NCCCCn2ccnc2)cccc1C(=O)O |
| InChI | InChI=1S/C14H18N4O2/c15-13-11(14(19)20)4-3-5-12(13)17-6-1-2-8-18-9-7-16-10-18/h3-5,7,9-10,17H,1-2,6,8,15H2,(H,19,20) |
| InChIKey | KJJOQMCFFRRAGQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|