C13H17N5S — CID 114288427
3-(4-imidazol-1-ylbutylamino)pyridine-4-carbothioamide (PubChem CID 114288427) has the molecular formula C13H17N5S and a molecular weight of 275.38 g/mol. Its IUPAC name is 3-(4-imidazol-1-ylbutylamino)pyridine-4-carbothioamide.
| Compound Name | 3-(4-imidazol-1-ylbutylamino)pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114288427 |
| Molecular Formula | C13H17N5S |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-(4-imidazol-1-ylbutylamino)pyridine-4-carbothioamide |
| SMILES | NC(=S)c1ccncc1NCCCCn1ccnc1 |
| InChI | InChI=1S/C13H17N5S/c14-13(19)11-3-5-15-9-12(11)17-4-1-2-7-18-8-6-16-10-18/h3,5-6,8-10,17H,1-2,4,7H2,(H2,14,19) |
| InChIKey | VMVRGQOXSHUHCM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|