C8H10FN3S — CID 130504428
3-(2-fluoroethylamino)pyridine-4-carbothioamide (PubChem CID 130504428) has the molecular formula C8H10FN3S and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-(2-fluoroethylamino)pyridine-4-carbothioamide.
| Compound Name | 3-(2-fluoroethylamino)pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 130504428 |
| Molecular Formula | C8H10FN3S |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 3-(2-fluoroethylamino)pyridine-4-carbothioamide |
| SMILES | NC(=S)c1ccncc1NCCF |
| InChI | InChI=1S/C8H10FN3S/c9-2-4-12-7-5-11-3-1-6(7)8(10)13/h1,3,5,12H,2,4H2,(H2,10,13) |
| InChIKey | UYLAMAYLEDOVPY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|