C9H9F4N3S — CID 106292919
3-(2,2,3,3-tetrafluoropropylamino)pyridine-4-carbothioamide (PubChem CID 106292919) has the molecular formula C9H9F4N3S and a molecular weight of 267.25 g/mol. Its IUPAC name is 3-(2,2,3,3-tetrafluoropropylamino)pyridine-4-carbothioamide.
| Compound Name | 3-(2,2,3,3-tetrafluoropropylamino)pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 106292919 |
| Molecular Formula | C9H9F4N3S |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 3-(2,2,3,3-tetrafluoropropylamino)pyridine-4-carbothioamide |
| SMILES | NC(=S)c1ccncc1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H9F4N3S/c10-8(11)9(12,13)4-16-6-3-15-2-1-5(6)7(14)17/h1-3,8,16H,4H2,(H2,14,17) |
| InChIKey | FEYQDBPCHDIAGC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|