C10H10F3N3S — CID 114159717
3-[[1-(trifluoromethyl)cyclopropyl]amino]pyridine-4-carbothioamide (PubChem CID 114159717) has the molecular formula C10H10F3N3S and a molecular weight of 261.27 g/mol. Its IUPAC name is 3-[[1-(trifluoromethyl)cyclopropyl]amino]pyridine-4-carbothioamide.
| Compound Name | 3-[[1-(trifluoromethyl)cyclopropyl]amino]pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114159717 |
| Molecular Formula | C10H10F3N3S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 3-[[1-(trifluoromethyl)cyclopropyl]amino]pyridine-4-carbothioamide |
| SMILES | NC(=S)c1ccncc1NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H10F3N3S/c11-10(12,13)9(2-3-9)16-7-5-15-4-1-6(7)8(14)17/h1,4-5,16H,2-3H2,(H2,14,17) |
| InChIKey | FZTRSLIWFKSOSI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|