C13H11F4N3S — CID 106292946
4-(2,2,3,3-tetrafluoropropylamino)quinoline-3-carbothioamide (PubChem CID 106292946) has the molecular formula C13H11F4N3S and a molecular weight of 317.31 g/mol. Its IUPAC name is 4-(2,2,3,3-tetrafluoropropylamino)quinoline-3-carbothioamide.
| Compound Name | 4-(2,2,3,3-tetrafluoropropylamino)quinoline-3-carbothioamide |
|---|---|
| PubChem CID | 106292946 |
| Molecular Formula | C13H11F4N3S |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-(2,2,3,3-tetrafluoropropylamino)quinoline-3-carbothioamide |
| SMILES | NC(=S)c1cnc2ccccc2c1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H11F4N3S/c14-12(15)13(16,17)6-20-10-7-3-1-2-4-9(7)19-5-8(10)11(18)21/h1-5,12H,6H2,(H2,18,21)(H,19,20) |
| InChIKey | GYXNOLHFORFGDA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|