C11H14N6S — CID 106302999
3-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]pyridine-4-carbothioamide (PubChem CID 106302999) has the molecular formula C11H14N6S and a molecular weight of 262.34 g/mol. Its IUPAC name is 3-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]pyridine-4-carbothioamide.
| Compound Name | 3-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 106302999 |
| Molecular Formula | C11H14N6S |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]pyridine-4-carbothioamide |
| SMILES | CCn1cnnc1CNc1cnccc1C(N)=S |
| InChI | InChI=1S/C11H14N6S/c1-2-17-7-15-16-10(17)6-14-9-5-13-4-3-8(9)11(12)18/h3-5,7,14H,2,6H2,1H3,(H2,12,18) |
| InChIKey | WCNCMQCJXCWSDL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|