C12H14N4S — CID 54951452
4-(2-imidazol-1-ylethylamino)benzenecarbothioamide (PubChem CID 54951452) has the molecular formula C12H14N4S and a molecular weight of 246.34 g/mol. Its IUPAC name is 4-(2-imidazol-1-ylethylamino)benzenecarbothioamide.
| Compound Name | 4-(2-imidazol-1-ylethylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 54951452 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-(2-imidazol-1-ylethylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCCn2ccnc2)cc1 |
| InChI | InChI=1S/C12H14N4S/c13-12(17)10-1-3-11(4-2-10)15-6-8-16-7-5-14-9-16/h1-5,7,9,15H,6,8H2,(H2,13,17) |
| InChIKey | MUUWMUXLQUHXRU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|