C10H11F3N2S — CID 63227391
4-(3,3,3-trifluoropropylamino)benzenecarbothioamide (PubChem CID 63227391) has the molecular formula C10H11F3N2S and a molecular weight of 248.27 g/mol. Its IUPAC name is 4-(3,3,3-trifluoropropylamino)benzenecarbothioamide.
| Compound Name | 4-(3,3,3-trifluoropropylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 63227391 |
| Molecular Formula | C10H11F3N2S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 4-(3,3,3-trifluoropropylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3N2S/c11-10(12,13)5-6-15-8-3-1-7(2-4-8)9(14)16/h1-4,15H,5-6H2,(H2,14,16) |
| InChIKey | VSSLVTGEXIAYED-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|