C9H13N3O2S2 — CID 43552530
4-(2-sulfamoylethylamino)benzenecarbothioamide (PubChem CID 43552530) has the molecular formula C9H13N3O2S2 and a molecular weight of 259.36 g/mol. Its IUPAC name is 4-(2-sulfamoylethylamino)benzenecarbothioamide.
| Compound Name | 4-(2-sulfamoylethylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 43552530 |
| Molecular Formula | C9H13N3O2S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 4-(2-sulfamoylethylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCCS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C9H13N3O2S2/c10-9(15)7-1-3-8(4-2-7)12-5-6-16(11,13)14/h1-4,12H,5-6H2,(H2,10,15)(H2,11,13,14) |
| InChIKey | WHPFOLDBGZIPAR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|