C11H18N2O3S — CID 114384994
2-(4-propoxyanilino)ethanesulfonamide (PubChem CID 114384994) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-(4-propoxyanilino)ethanesulfonamide.
| Compound Name | 2-(4-propoxyanilino)ethanesulfonamide |
|---|---|
| PubChem CID | 114384994 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-(4-propoxyanilino)ethanesulfonamide |
| SMILES | CCCOc1ccc(NCCS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H18N2O3S/c1-2-8-16-11-5-3-10(4-6-11)13-7-9-17(12,14)15/h3-6,13H,2,7-9H2,1H3,(H2,12,14,15) |
| InChIKey | PCNXFJNODFCPRA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|