C8H11ClN2O2S — CID 114384668
2-(4-chloroanilino)ethanesulfonamide (PubChem CID 114384668) has the molecular formula C8H11ClN2O2S and a molecular weight of 234.71 g/mol. Its IUPAC name is 2-(4-chloroanilino)ethanesulfonamide.
| Compound Name | 2-(4-chloroanilino)ethanesulfonamide |
|---|---|
| PubChem CID | 114384668 |
| Molecular Formula | C8H11ClN2O2S |
| Molecular Weight | 234.71 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 2-(4-chloroanilino)ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H11ClN2O2S/c9-7-1-3-8(4-2-7)11-5-6-14(10,12)13/h1-4,11H,5-6H2,(H2,10,12,13) |
| InChIKey | GKHOEJQKFJYPEQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.71 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |