C16H18N2OS — CID 106261364
4-[2-(2-methoxyphenyl)ethylamino]benzenecarbothioamide (PubChem CID 106261364) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is 4-[2-(2-methoxyphenyl)ethylamino]benzenecarbothioamide.
| Compound Name | 4-[2-(2-methoxyphenyl)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 106261364 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-[2-(2-methoxyphenyl)ethylamino]benzenecarbothioamide |
| SMILES | COc1ccccc1CCNc1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C16H18N2OS/c1-19-15-5-3-2-4-12(15)10-11-18-14-8-6-13(7-9-14)16(17)20/h2-9,18H,10-11H2,1H3,(H2,17,20) |
| InChIKey | PVNJUZKXKNQRAT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|