C13H19NO3 — CID 94687146
2-[2-(2-methoxyphenyl)ethylamino]-2-methylpropanoic acid (PubChem CID 94687146) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenyl)ethylamino]-2-methylpropanoic acid.
| Compound Name | 2-[2-(2-methoxyphenyl)ethylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 94687146 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-[2-(2-methoxyphenyl)ethylamino]-2-methylpropanoic acid |
| SMILES | COc1ccccc1CCNC(C)(C)C(=O)O |
| InChI | InChI=1S/C13H19NO3/c1-13(2,12(15)16)14-9-8-10-6-4-5-7-11(10)17-3/h4-7,14H,8-9H2,1-3H3,(H,15,16) |
| InChIKey | DKVFBISGNCPTQX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |