C13H20F2N2O2S — CID 107844931
N'-[2-(difluoromethylsulfonyl)phenyl]hexane-1,6-diamine (PubChem CID 107844931) has the molecular formula C13H20F2N2O2S and a molecular weight of 306.38 g/mol. Its IUPAC name is N'-[2-(difluoromethylsulfonyl)phenyl]hexane-1,6-diamine.
| Compound Name | N'-[2-(difluoromethylsulfonyl)phenyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 107844931 |
| Molecular Formula | C13H20F2N2O2S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N'-[2-(difluoromethylsulfonyl)phenyl]hexane-1,6-diamine |
| SMILES | NCCCCCCNc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C13H20F2N2O2S/c14-13(15)20(18,19)12-8-4-3-7-11(12)17-10-6-2-1-5-9-16/h3-4,7-8,13,17H,1-2,5-6,9-10,16H2 |
| InChIKey | ACUYXFAXEJBUAN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|