C11H16F2N2O4S2 — CID 106337997
2-[2-(difluoromethylsulfonyl)anilino]-N-ethylethanesulfonamide (PubChem CID 106337997) has the molecular formula C11H16F2N2O4S2 and a molecular weight of 342.39 g/mol. Its IUPAC name is 2-[2-(difluoromethylsulfonyl)anilino]-N-ethylethanesulfonamide.
| Compound Name | 2-[2-(difluoromethylsulfonyl)anilino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 106337997 |
| Molecular Formula | C11H16F2N2O4S2 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 2-[2-(difluoromethylsulfonyl)anilino]-N-ethylethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C11H16F2N2O4S2/c1-2-15-20(16,17)8-7-14-9-5-3-4-6-10(9)21(18,19)11(12)13/h3-6,11,14-15H,2,7-8H2,1H3 |
| InChIKey | DTXYBKRYCIJAFX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |