C12H17F2NO4S — CID 103875676
4-[2-(difluoromethylsulfonyl)anilino]-1-methoxybutan-2-ol (PubChem CID 103875676) has the molecular formula C12H17F2NO4S and a molecular weight of 309.33 g/mol. Its IUPAC name is 4-[2-(difluoromethylsulfonyl)anilino]-1-methoxybutan-2-ol.
| Compound Name | 4-[2-(difluoromethylsulfonyl)anilino]-1-methoxybutan-2-ol |
|---|---|
| PubChem CID | 103875676 |
| Molecular Formula | C12H17F2NO4S |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-[2-(difluoromethylsulfonyl)anilino]-1-methoxybutan-2-ol |
| SMILES | COCC(O)CCNc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C12H17F2NO4S/c1-19-8-9(16)6-7-15-10-4-2-3-5-11(10)20(17,18)12(13)14/h2-5,9,12,15-16H,6-8H2,1H3 |
| InChIKey | IYSPIVOHMWKHFJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |