C9H13F2N3O2S — CID 114384513
2-[(3-amino-2,2-difluoropropyl)amino]benzenesulfonamide (PubChem CID 114384513) has the molecular formula C9H13F2N3O2S and a molecular weight of 265.28 g/mol. Its IUPAC name is 2-[(3-amino-2,2-difluoropropyl)amino]benzenesulfonamide.
| Compound Name | 2-[(3-amino-2,2-difluoropropyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 114384513 |
| Molecular Formula | C9H13F2N3O2S |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-[(3-amino-2,2-difluoropropyl)amino]benzenesulfonamide |
| SMILES | NCC(F)(F)CNc1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C9H13F2N3O2S/c10-9(11,5-12)6-14-7-3-1-2-4-8(7)17(13,15)16/h1-4,14H,5-6,12H2,(H2,13,15,16) |
| InChIKey | PKIWPLLQVWGHQR-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |