C9H10F4N2O2S — CID 106293975
2-(2,2,3,3-tetrafluoropropylamino)benzenesulfonamide (PubChem CID 106293975) has the molecular formula C9H10F4N2O2S and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropylamino)benzenesulfonamide.
| Compound Name | 2-(2,2,3,3-tetrafluoropropylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 106293975 |
| Molecular Formula | C9H10F4N2O2S |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H10F4N2O2S/c10-8(11)9(12,13)5-15-6-3-1-2-4-7(6)18(14,16)17/h1-4,8,15H,5H2,(H2,14,16,17) |
| InChIKey | YHJFWKZFJXUZAO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|