C11H17FN2O4S2 — CID 63855523
4-fluoro-2-(3-methylbutylsulfonylamino)benzenesulfonamide (PubChem CID 63855523) has the molecular formula C11H17FN2O4S2 and a molecular weight of 324.40 g/mol. Its IUPAC name is 4-fluoro-2-(3-methylbutylsulfonylamino)benzenesulfonamide.
| Compound Name | 4-fluoro-2-(3-methylbutylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 63855523 |
| Molecular Formula | C11H17FN2O4S2 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 4-fluoro-2-(3-methylbutylsulfonylamino)benzenesulfonamide |
| SMILES | CC(C)CCS(=O)(=O)Nc1cc(F)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C11H17FN2O4S2/c1-8(2)5-6-19(15,16)14-10-7-9(12)3-4-11(10)20(13,17)18/h3-4,7-8,14H,5-6H2,1-2H3,(H2,13,17,18) |
| InChIKey | AJROPQYKXLATIG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |