C7H7F3N2O4S2 — CID 61132903
2-(difluoromethylsulfonylamino)-4-fluorobenzenesulfonamide (PubChem CID 61132903) has the molecular formula C7H7F3N2O4S2 and a molecular weight of 304.27 g/mol. Its IUPAC name is 2-(difluoromethylsulfonylamino)-4-fluorobenzenesulfonamide.
| Compound Name | 2-(difluoromethylsulfonylamino)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 61132903 |
| Molecular Formula | C7H7F3N2O4S2 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 2-(difluoromethylsulfonylamino)-4-fluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(F)cc1NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C7H7F3N2O4S2/c8-4-1-2-6(17(11,13)14)5(3-4)12-18(15,16)7(9)10/h1-3,7,12H,(H2,11,13,14) |
| InChIKey | UZUBIUGXJRELTQ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |