C13H15FN2O3S — CID 61130912
N-(5-fluoro-2-sulfamoylphenyl)cyclohex-3-ene-1-carboxamide (PubChem CID 61130912) has the molecular formula C13H15FN2O3S and a molecular weight of 298.34 g/mol. Its IUPAC name is N-(5-fluoro-2-sulfamoylphenyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-(5-fluoro-2-sulfamoylphenyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 61130912 |
| Molecular Formula | C13H15FN2O3S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | N-(5-fluoro-2-sulfamoylphenyl)cyclohex-3-ene-1-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(F)cc1NC(=O)C1CC=CCC1 |
| InChI | InChI=1S/C13H15FN2O3S/c14-10-6-7-12(20(15,18)19)11(8-10)16-13(17)9-4-2-1-3-5-9/h1-2,6-9H,3-5H2,(H,16,17)(H2,15,18,19) |
| InChIKey | XOBQIULPKMEHMK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|