C12H18FN3O4S — CID 79593088
2-fluoro-N'-hydroxy-6-(2-propan-2-yloxyethylsulfonylamino)benzenecarboximidamide (PubChem CID 79593088) has the molecular formula C12H18FN3O4S and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-fluoro-N'-hydroxy-6-(2-propan-2-yloxyethylsulfonylamino)benzenecarboximidamide.
| Compound Name | 2-fluoro-N'-hydroxy-6-(2-propan-2-yloxyethylsulfonylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 79593088 |
| Molecular Formula | C12H18FN3O4S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-fluoro-N'-hydroxy-6-(2-propan-2-yloxyethylsulfonylamino)benzenecarboximidamide |
| SMILES | CC(C)OCCS(=O)(=O)Nc1cccc(F)c1C(N)=NO |
| InChI | InChI=1S/C12H18FN3O4S/c1-8(2)20-6-7-21(18,19)16-10-5-3-4-9(13)11(10)12(14)15-17/h3-5,8,16-17H,6-7H2,1-2H3,(H2,14,15) |
| InChIKey | JQJKLIXMQBMYDC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|