C10H17N3O6S2 — CID 114816629
4-methoxy-3-(2-methoxyethylsulfamoylamino)benzenesulfonamide (PubChem CID 114816629) has the molecular formula C10H17N3O6S2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-methoxy-3-(2-methoxyethylsulfamoylamino)benzenesulfonamide.
| Compound Name | 4-methoxy-3-(2-methoxyethylsulfamoylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 114816629 |
| Molecular Formula | C10H17N3O6S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 4-methoxy-3-(2-methoxyethylsulfamoylamino)benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)Nc1cc(S(N)(=O)=O)ccc1OC |
| InChI | InChI=1S/C10H17N3O6S2/c1-18-6-5-12-21(16,17)13-9-7-8(20(11,14)15)3-4-10(9)19-2/h3-4,7,12-13H,5-6H2,1-2H3,(H2,11,14,15) |
| InChIKey | MAEPFZFPWKIHAG-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|