C11H19N3O5S2 — CID 114812448
3-(tert-butylsulfamoylamino)-4-methoxybenzenesulfonamide (PubChem CID 114812448) has the molecular formula C11H19N3O5S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-(tert-butylsulfamoylamino)-4-methoxybenzenesulfonamide.
| Compound Name | 3-(tert-butylsulfamoylamino)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 114812448 |
| Molecular Formula | C11H19N3O5S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 3-(tert-butylsulfamoylamino)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1NS(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H19N3O5S2/c1-11(2,3)14-21(17,18)13-9-7-8(20(12,15)16)5-6-10(9)19-4/h5-7,13-14H,1-4H3,(H2,12,15,16) |
| InChIKey | AYYRFQYSECTGOK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |