C14H13ClN2O7S2 — CID 100820520
4-chloro-3-[(2-methoxy-5-sulfamoylphenyl)sulfamoyl]benzoic acid (PubChem CID 100820520) has the molecular formula C14H13ClN2O7S2 and a molecular weight of 420.85 g/mol. Its IUPAC name is 4-chloro-3-[(2-methoxy-5-sulfamoylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 4-chloro-3-[(2-methoxy-5-sulfamoylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 100820520 |
| Molecular Formula | C14H13ClN2O7S2 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 4-chloro-3-[(2-methoxy-5-sulfamoylphenyl)sulfamoyl]benzoic acid |
| SMILES | COc1ccc(S(N)(=O)=O)cc1NS(=O)(=O)c1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C14H13ClN2O7S2/c1-24-12-5-3-9(25(16,20)21)7-11(12)17-26(22,23)13-6-8(14(18)19)2-4-10(13)15/h2-7,17H,1H3,(H,18,19)(H2,16,20,21) |
| InChIKey | KFFHPODJGYZDAC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 152.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |