C21H19BrClN3O6S2 — CID 4845355
3-[(5-bromo-2-methoxyphenyl)sulfamoyl]-4-chloro-N-[(4-sulfamoylphenyl)methyl]benzamide (PubChem CID 4845355) has the molecular formula C21H19BrClN3O6S2 and a molecular weight of 588.89 g/mol. Its IUPAC name is 3-[(5-bromo-2-methoxyphenyl)sulfamoyl]-4-chloro-N-[(4-sulfamoylphenyl)methyl]benzamide.
| Compound Name | 3-[(5-bromo-2-methoxyphenyl)sulfamoyl]-4-chloro-N-[(4-sulfamoylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 4845355 |
| Molecular Formula | C21H19BrClN3O6S2 |
| Molecular Weight | 588.89 g/mol |
| Exact Mass | 586.96 |
| IUPAC Name | 3-[(5-bromo-2-methoxyphenyl)sulfamoyl]-4-chloro-N-[(4-sulfamoylphenyl)methyl]benzamide |
| SMILES | COc1ccc(Br)cc1NS(=O)(=O)c1cc(C(=O)NCc2ccc(S(N)(=O)=O)cc2)ccc1Cl |
| InChI | InChI=1S/C21H19BrClN3O6S2/c1-32-19-9-5-15(22)11-18(19)26-34(30,31)20-10-14(4-8-17(20)23)21(27)25-12-13-2-6-16(7-3-13)33(24,28)29/h2-11,26H,12H2,1H3,(H,25,27)(H2,24,28,29) |
| InChIKey | SFVKHOAPHKYDSS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.89 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |