C12H13BrN2O4S — CID 43743930
3-[(5-bromofuran-2-yl)methylamino]-4-methoxybenzenesulfonamide (PubChem CID 43743930) has the molecular formula C12H13BrN2O4S and a molecular weight of 361.22 g/mol. Its IUPAC name is 3-[(5-bromofuran-2-yl)methylamino]-4-methoxybenzenesulfonamide.
| Compound Name | 3-[(5-bromofuran-2-yl)methylamino]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 43743930 |
| Molecular Formula | C12H13BrN2O4S |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 3-[(5-bromofuran-2-yl)methylamino]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1NCc1ccc(Br)o1 |
| InChI | InChI=1S/C12H13BrN2O4S/c1-18-11-4-3-9(20(14,16)17)6-10(11)15-7-8-2-5-12(13)19-8/h2-6,15H,7H2,1H3,(H2,14,16,17) |
| InChIKey | PXIFLEODCOHWTG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |