C12H12Br2N2O3S2 — CID 102833850
3-[(4,5-dibromothiophen-2-yl)methylamino]-4-methoxybenzenesulfonamide (PubChem CID 102833850) has the molecular formula C12H12Br2N2O3S2 and a molecular weight of 456.18 g/mol. Its IUPAC name is 3-[(4,5-dibromothiophen-2-yl)methylamino]-4-methoxybenzenesulfonamide.
| Compound Name | 3-[(4,5-dibromothiophen-2-yl)methylamino]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 102833850 |
| Molecular Formula | C12H12Br2N2O3S2 |
| Molecular Weight | 456.18 g/mol |
| Exact Mass | 453.87 |
| IUPAC Name | 3-[(4,5-dibromothiophen-2-yl)methylamino]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1NCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H12Br2N2O3S2/c1-19-11-3-2-8(21(15,17)18)5-10(11)16-6-7-4-9(13)12(14)20-7/h2-5,16H,6H2,1H3,(H2,15,17,18) |
| InChIKey | URKSYLYSOLNGQH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |