C13H13Br2NO2S — CID 102830299
N-[(4,5-dibromothiophen-2-yl)methyl]-3,4-dimethoxyaniline (PubChem CID 102830299) has the molecular formula C13H13Br2NO2S and a molecular weight of 407.13 g/mol. Its IUPAC name is N-[(4,5-dibromothiophen-2-yl)methyl]-3,4-dimethoxyaniline.
| Compound Name | N-[(4,5-dibromothiophen-2-yl)methyl]-3,4-dimethoxyaniline |
|---|---|
| PubChem CID | 102830299 |
| Molecular Formula | C13H13Br2NO2S |
| Molecular Weight | 407.13 g/mol |
| Exact Mass | 404.90 |
| IUPAC Name | N-[(4,5-dibromothiophen-2-yl)methyl]-3,4-dimethoxyaniline |
| SMILES | COc1ccc(NCc2cc(Br)c(Br)s2)cc1OC |
| InChI | InChI=1S/C13H13Br2NO2S/c1-17-11-4-3-8(5-12(11)18-2)16-7-9-6-10(14)13(15)19-9/h3-6,16H,7H2,1-2H3 |
| InChIKey | QPDVYDMMLDMUTE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.13 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|