C11H7Br2Cl2NS — CID 102830389
3,4-dichloro-N-[(4,5-dibromothiophen-2-yl)methyl]aniline (PubChem CID 102830389) has the molecular formula C11H7Br2Cl2NS and a molecular weight of 415.97 g/mol. Its IUPAC name is 3,4-dichloro-N-[(4,5-dibromothiophen-2-yl)methyl]aniline.
| Compound Name | 3,4-dichloro-N-[(4,5-dibromothiophen-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 102830389 |
| Molecular Formula | C11H7Br2Cl2NS |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 412.80 |
| IUPAC Name | 3,4-dichloro-N-[(4,5-dibromothiophen-2-yl)methyl]aniline |
| SMILES | Clc1ccc(NCc2cc(Br)c(Br)s2)cc1Cl |
| InChI | InChI=1S/C11H7Br2Cl2NS/c12-8-4-7(17-11(8)13)5-16-6-1-2-9(14)10(15)3-6/h1-4,16H,5H2 |
| InChIKey | BCCSSVUBHJKMAG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |