C13H10Br2N4S — CID 102833743
N-[(4,5-dibromothiophen-2-yl)methyl]-4-(triazol-2-yl)aniline (PubChem CID 102833743) has the molecular formula C13H10Br2N4S and a molecular weight of 414.13 g/mol. Its IUPAC name is N-[(4,5-dibromothiophen-2-yl)methyl]-4-(triazol-2-yl)aniline.
| Compound Name | N-[(4,5-dibromothiophen-2-yl)methyl]-4-(triazol-2-yl)aniline |
|---|---|
| PubChem CID | 102833743 |
| Molecular Formula | C13H10Br2N4S |
| Molecular Weight | 414.13 g/mol |
| Exact Mass | 411.90 |
| IUPAC Name | N-[(4,5-dibromothiophen-2-yl)methyl]-4-(triazol-2-yl)aniline |
| SMILES | Brc1cc(CNc2ccc(-n3nccn3)cc2)sc1Br |
| InChI | InChI=1S/C13H10Br2N4S/c14-12-7-11(20-13(12)15)8-16-9-1-3-10(4-2-9)19-17-5-6-18-19/h1-7,16H,8H2 |
| InChIKey | STTRFEOSYAOACY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.13 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |