About 4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline
4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline (PubChem CID 102832655) has the molecular formula C16H17Br2NOS
and a molecular weight of 431.19 g/mol. Its IUPAC name is 4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline.
Molecular Properties
| Compound Name | 4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline |
| PubChem CID | 102832655 |
| Molecular Formula | C16H17Br2NOS |
| Molecular Weight | 431.19 g/mol |
| Exact Mass | 428.94 |
| IUPAC Name | 4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline |
| SMILES | Brc1cc(CNc2ccc(OC3CCCC3)cc2)sc1Br |
| InChI | InChI=1S/C16H17Br2NOS/c17-15-9-14(21-16(15)18)10-19-11-5-7-13(8-6-11)20-12-3-1-2-4-12/h5-9,12,19H,1-4,10H2 |
| InChIKey | YQMWWIBNCOSPCZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.19 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline?
The IUPAC name of 4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline (CID 102832655) is 4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline.
What is the SMILES notation for 4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline?
The canonical SMILES for 4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline is Brc1cc(CNc2ccc(OC3CCCC3)cc2)sc1Br.
What is the InChIKey of 4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline?
The InChIKey is YQMWWIBNCOSPCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Br2NOS/c17-15-9-14(21-16(15)18)10-19-11-5-7-13(8-6-11)20-12-3-1-2-4-12/h5-9,12,19H,1-4,10H2.
What are the key properties of 4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline?
4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline has a molecular weight of 431.19 g/mol, XLogP of 6.21, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentyloxy-N-[(4,5-dibromothiophen-2-yl)methyl]aniline is sourced from PubChem (CID 102832655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).