C14H11Br2N3S — CID 102833729
N-[(4,5-dibromothiophen-2-yl)methyl]-3-pyrazol-1-ylaniline (PubChem CID 102833729) has the molecular formula C14H11Br2N3S and a molecular weight of 413.14 g/mol. Its IUPAC name is N-[(4,5-dibromothiophen-2-yl)methyl]-3-pyrazol-1-ylaniline.
| Compound Name | N-[(4,5-dibromothiophen-2-yl)methyl]-3-pyrazol-1-ylaniline |
|---|---|
| PubChem CID | 102833729 |
| Molecular Formula | C14H11Br2N3S |
| Molecular Weight | 413.14 g/mol |
| Exact Mass | 410.90 |
| IUPAC Name | N-[(4,5-dibromothiophen-2-yl)methyl]-3-pyrazol-1-ylaniline |
| SMILES | Brc1cc(CNc2cccc(-n3cccn3)c2)sc1Br |
| InChI | InChI=1S/C14H11Br2N3S/c15-13-8-12(20-14(13)16)9-17-10-3-1-4-11(7-10)19-6-2-5-18-19/h1-8,17H,9H2 |
| InChIKey | YBPUSTHXZDPIPI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.14 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |