C13H9Br2NS — CID 102829922
N-[(4,5-dibromothiophen-2-yl)methyl]-3-ethynylaniline (PubChem CID 102829922) has the molecular formula C13H9Br2NS and a molecular weight of 371.10 g/mol. Its IUPAC name is N-[(4,5-dibromothiophen-2-yl)methyl]-3-ethynylaniline.
| Compound Name | N-[(4,5-dibromothiophen-2-yl)methyl]-3-ethynylaniline |
|---|---|
| PubChem CID | 102829922 |
| Molecular Formula | C13H9Br2NS |
| Molecular Weight | 371.10 g/mol |
| Exact Mass | 368.88 |
| IUPAC Name | N-[(4,5-dibromothiophen-2-yl)methyl]-3-ethynylaniline |
| SMILES | C#Cc1cccc(NCc2cc(Br)c(Br)s2)c1 |
| InChI | InChI=1S/C13H9Br2NS/c1-2-9-4-3-5-10(6-9)16-8-11-7-12(14)13(15)17-11/h1,3-7,16H,8H2 |
| InChIKey | QZNAAFPXQYAVPP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.10 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|