C14H14Br2N2OS — CID 102833214
3-[(4,5-dibromothiophen-2-yl)methylamino]-N,N-dimethylbenzamide (PubChem CID 102833214) has the molecular formula C14H14Br2N2OS and a molecular weight of 418.15 g/mol. Its IUPAC name is 3-[(4,5-dibromothiophen-2-yl)methylamino]-N,N-dimethylbenzamide.
| Compound Name | 3-[(4,5-dibromothiophen-2-yl)methylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 102833214 |
| Molecular Formula | C14H14Br2N2OS |
| Molecular Weight | 418.15 g/mol |
| Exact Mass | 415.92 |
| IUPAC Name | 3-[(4,5-dibromothiophen-2-yl)methylamino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NCc2cc(Br)c(Br)s2)c1 |
| InChI | InChI=1S/C14H14Br2N2OS/c1-18(2)14(19)9-4-3-5-10(6-9)17-8-11-7-12(15)13(16)20-11/h3-7,17H,8H2,1-2H3 |
| InChIKey | ZQPAICFHQMIRAV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.15 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |