C14H18N4O — CID 43725385
N,N-dimethyl-3-[(1-methylpyrazol-4-yl)methylamino]benzamide (PubChem CID 43725385) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is N,N-dimethyl-3-[(1-methylpyrazol-4-yl)methylamino]benzamide.
| Compound Name | N,N-dimethyl-3-[(1-methylpyrazol-4-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 43725385 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N,N-dimethyl-3-[(1-methylpyrazol-4-yl)methylamino]benzamide |
| SMILES | CN(C)C(=O)c1cccc(NCc2cnn(C)c2)c1 |
| InChI | InChI=1S/C14H18N4O/c1-17(2)14(19)12-5-4-6-13(7-12)15-8-11-9-16-18(3)10-11/h4-7,9-10,15H,8H2,1-3H3 |
| InChIKey | GOXLVURHQQHLJU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |