C16H17FN2O2 — CID 107685516
3-[(3-fluoro-4-hydroxyphenyl)methylamino]-N,N-dimethylbenzamide (PubChem CID 107685516) has the molecular formula C16H17FN2O2 and a molecular weight of 288.32 g/mol. Its IUPAC name is 3-[(3-fluoro-4-hydroxyphenyl)methylamino]-N,N-dimethylbenzamide.
| Compound Name | 3-[(3-fluoro-4-hydroxyphenyl)methylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 107685516 |
| Molecular Formula | C16H17FN2O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 3-[(3-fluoro-4-hydroxyphenyl)methylamino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NCc2ccc(O)c(F)c2)c1 |
| InChI | InChI=1S/C16H17FN2O2/c1-19(2)16(21)12-4-3-5-13(9-12)18-10-11-6-7-15(20)14(17)8-11/h3-9,18,20H,10H2,1-2H3 |
| InChIKey | YAVZGZVAXDTIDU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |