C17H17F2N3O2 — CID 37275657
3-[[2-(3,5-difluoroanilino)-2-oxoethyl]amino]-N,N-dimethylbenzamide (PubChem CID 37275657) has the molecular formula C17H17F2N3O2 and a molecular weight of 333.34 g/mol. Its IUPAC name is 3-[[2-(3,5-difluoroanilino)-2-oxoethyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-(3,5-difluoroanilino)-2-oxoethyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 37275657 |
| Molecular Formula | C17H17F2N3O2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 3-[[2-(3,5-difluoroanilino)-2-oxoethyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NCC(=O)Nc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C17H17F2N3O2/c1-22(2)17(24)11-4-3-5-14(6-11)20-10-16(23)21-15-8-12(18)7-13(19)9-15/h3-9,20H,10H2,1-2H3,(H,21,23) |
| InChIKey | CQCQDWDZKNMRJZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |