C21H25FN4O3 — CID 86960546
N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-N'-[3-(dimethylcarbamoyl)phenyl]oxamide (PubChem CID 86960546) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-N'-[3-(dimethylcarbamoyl)phenyl]oxamide.
| Compound Name | N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-N'-[3-(dimethylcarbamoyl)phenyl]oxamide |
|---|---|
| PubChem CID | 86960546 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-N'-[3-(dimethylcarbamoyl)phenyl]oxamide |
| SMILES | CN(C)Cc1cc(CNC(=O)C(=O)Nc2cccc(C(=O)N(C)C)c2)ccc1F |
| InChI | InChI=1S/C21H25FN4O3/c1-25(2)13-16-10-14(8-9-18(16)22)12-23-19(27)20(28)24-17-7-5-6-15(11-17)21(29)26(3)4/h5-11H,12-13H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | SOAWIUDRWLCQIE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|