C18H19N3O3 — CID 108514930
N'-(3-acetylphenyl)-N-[[3-(aminomethyl)phenyl]methyl]oxamide (PubChem CID 108514930) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N'-(3-acetylphenyl)-N-[[3-(aminomethyl)phenyl]methyl]oxamide.
| Compound Name | N'-(3-acetylphenyl)-N-[[3-(aminomethyl)phenyl]methyl]oxamide |
|---|---|
| PubChem CID | 108514930 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N'-(3-acetylphenyl)-N-[[3-(aminomethyl)phenyl]methyl]oxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(=O)NCc2cccc(CN)c2)c1 |
| InChI | InChI=1S/C18H19N3O3/c1-12(22)15-6-3-7-16(9-15)21-18(24)17(23)20-11-14-5-2-4-13(8-14)10-19/h2-9H,10-11,19H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | MWYZXEGEAKDTFC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|