C18H21N3O2 — CID 108519011
N-[[3-(aminomethyl)phenyl]methyl]-N'-(2,5-dimethylphenyl)oxamide (PubChem CID 108519011) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-N'-(2,5-dimethylphenyl)oxamide.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-N'-(2,5-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 108519011 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-N'-(2,5-dimethylphenyl)oxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(=O)NCc2cccc(CN)c2)c1 |
| InChI | InChI=1S/C18H21N3O2/c1-12-6-7-13(2)16(8-12)21-18(23)17(22)20-11-15-5-3-4-14(9-15)10-19/h3-9H,10-11,19H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | WDXHKARQYUKDJH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|