C12H10BrClN2OS — CID 102830891
3-[(4-bromo-5-chlorothiophen-2-yl)methylamino]benzamide (PubChem CID 102830891) has the molecular formula C12H10BrClN2OS and a molecular weight of 345.65 g/mol. Its IUPAC name is 3-[(4-bromo-5-chlorothiophen-2-yl)methylamino]benzamide.
| Compound Name | 3-[(4-bromo-5-chlorothiophen-2-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 102830891 |
| Molecular Formula | C12H10BrClN2OS |
| Molecular Weight | 345.65 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | 3-[(4-bromo-5-chlorothiophen-2-yl)methylamino]benzamide |
| SMILES | NC(=O)c1cccc(NCc2cc(Br)c(Cl)s2)c1 |
| InChI | InChI=1S/C12H10BrClN2OS/c13-10-5-9(18-11(10)14)6-16-8-3-1-2-7(4-8)12(15)17/h1-5,16H,6H2,(H2,15,17) |
| InChIKey | BCAZNQMCKSTJPQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.65 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |